About methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate
methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate (PubChem CID 11137789) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate.
Molecular Properties
| Compound Name | methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate |
| PubChem CID | 11137789 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate |
| SMILES | CS/C(C=C=C(C)C)=N\C(C)C |
| InChI | InChI=1S/C10H17NS/c1-8(2)6-7-10(12-5)11-9(3)4/h7,9H,1-5H3/b11-10- |
| InChIKey | AIRWXNGHZFCOTP-KHPPLWFESA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate?
The IUPAC name of methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate (CID 11137789) is methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate.
What is the SMILES notation for methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate?
The canonical SMILES for methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate is CS/C(C=C=C(C)C)=N\C(C)C.
What is the InChIKey of methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate?
The InChIKey is AIRWXNGHZFCOTP-KHPPLWFESA-N. The full InChI is InChI=1S/C10H17NS/c1-8(2)6-7-10(12-5)11-9(3)4/h7,9H,1-5H3/b11-10-.
What are the key properties of methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate?
methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate has a molecular weight of 183.32 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-N-propan-2-ylpenta-2,3-dienimidothioate is sourced from PubChem (CID 11137789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).