About methyl N-ethyl-4-methylpenta-2,3-dienimidothioate
methyl N-ethyl-4-methylpenta-2,3-dienimidothioate (PubChem CID 11829857) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is methyl N-ethyl-4-methylpenta-2,3-dienimidothioate.
Molecular Properties
| Compound Name | methyl N-ethyl-4-methylpenta-2,3-dienimidothioate |
| PubChem CID | 11829857 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | methyl N-ethyl-4-methylpenta-2,3-dienimidothioate |
| SMILES | CC/N=C(/C=C=C(C)C)SC |
| InChI | InChI=1S/C9H15NS/c1-5-10-9(11-4)7-6-8(2)3/h7H,5H2,1-4H3/b10-9- |
| InChIKey | WWIJZHSFBMEGRW-KTKRTIGZSA-N |
| XLogP | 2.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-ethyl-4-methylpenta-2,3-dienimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-ethyl-4-methylpenta-2,3-dienimidothioate?
The IUPAC name of methyl N-ethyl-4-methylpenta-2,3-dienimidothioate (CID 11829857) is methyl N-ethyl-4-methylpenta-2,3-dienimidothioate.
What is the SMILES notation for methyl N-ethyl-4-methylpenta-2,3-dienimidothioate?
The canonical SMILES for methyl N-ethyl-4-methylpenta-2,3-dienimidothioate is CC/N=C(/C=C=C(C)C)SC.
What is the InChIKey of methyl N-ethyl-4-methylpenta-2,3-dienimidothioate?
The InChIKey is WWIJZHSFBMEGRW-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H15NS/c1-5-10-9(11-4)7-6-8(2)3/h7H,5H2,1-4H3/b10-9-.
What are the key properties of methyl N-ethyl-4-methylpenta-2,3-dienimidothioate?
methyl N-ethyl-4-methylpenta-2,3-dienimidothioate has a molecular weight of 169.29 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-ethyl-4-methylpenta-2,3-dienimidothioate is sourced from PubChem (CID 11829857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).