C19H27IN4O2 — CID 111378096
4-[[N-[1-(1-benzofuran-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-cyclopropylbutanamide;hydroiodide (PubChem CID 111378096) has the molecular formula C19H27IN4O2 and a molecular weight of 470.36 g/mol. Its IUPAC name is 4-[[N-[1-(1-benzofuran-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-cyclopropylbutanamide;hydroiodide.
| Compound Name | 4-[[N-[1-(1-benzofuran-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-cyclopropylbutanamide;hydroiodide |
|---|---|
| PubChem CID | 111378096 |
| Molecular Formula | C19H27IN4O2 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 4-[[N-[1-(1-benzofuran-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N-cyclopropylbutanamide;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)NC(C)c1cc2ccccc2o1.I |
| InChI | InChI=1S/C19H26N4O2.HI/c1-13(17-12-14-6-3-4-7-16(14)25-17)22-19(20-2)21-11-5-8-18(24)23-15-9-10-15;/h3-4,6-7,12-13,15H,5,8-11H2,1-2H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | ZQWISKYGPGUNNQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|