C18H24N4O2 — CID 119133281
2-[[[1-(1-benzofuran-2-yl)ethylamino]-(cyclopropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 119133281) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[[[1-(1-benzofuran-2-yl)ethylamino]-(cyclopropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[1-(1-benzofuran-2-yl)ethylamino]-(cyclopropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 119133281 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-[[[1-(1-benzofuran-2-yl)ethylamino]-(cyclopropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC(N/C(=N/CC(=O)N(C)C)NC1CC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H24N4O2/c1-12(16-10-13-6-4-5-7-15(13)24-16)20-18(21-14-8-9-14)19-11-17(23)22(2)3/h4-7,10,12,14H,8-9,11H2,1-3H3,(H2,19,20,21) |
| InChIKey | XBAHAAGIZIPJQZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|