C22H28IN3O4 — CID 111378176
1-[1-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111378176) has the molecular formula C22H28IN3O4 and a molecular weight of 525.39 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111378176 |
| Molecular Formula | C22H28IN3O4 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(O)c(OC)c1)NC(C)c1cc2ccccc2o1.I |
| InChI | InChI=1S/C22H27N3O4.HI/c1-5-23-22(24-13-15-10-19(27-3)21(26)20(11-15)28-4)25-14(2)18-12-16-8-6-7-9-17(16)29-18;/h6-12,14,26H,5,13H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | HRLZVDXXHGTSFY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|