C21H26IN3O3 — CID 111378253
1-[1-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111378253) has the molecular formula C21H26IN3O3 and a molecular weight of 495.36 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111378253 |
| Molecular Formula | C21H26IN3O3 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)NC(C)c1cc2ccccc2o1.I |
| InChI | InChI=1S/C21H25N3O3.HI/c1-4-22-21(23-13-16-9-7-11-18(26-3)20(16)25)24-14(2)19-12-15-8-5-6-10-17(15)27-19;/h5-12,14,25H,4,13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | KGMQRCOLVZKRGE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|