C19H33IN4O2 — CID 111378831
N-tert-butyl-2-[[N-ethyl-N'-[2-hydroxy-2-(4-methylphenyl)ethyl]carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111378831) has the molecular formula C19H33IN4O2 and a molecular weight of 476.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-ethyl-N'-[2-hydroxy-2-(4-methylphenyl)ethyl]carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-ethyl-N'-[2-hydroxy-2-(4-methylphenyl)ethyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111378831 |
| Molecular Formula | C19H33IN4O2 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-tert-butyl-2-[[N-ethyl-N'-[2-hydroxy-2-(4-methylphenyl)ethyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(C)cc1)N(C)CC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C19H32N4O2.HI/c1-7-20-18(23(6)13-17(25)22-19(3,4)5)21-12-16(24)15-10-8-14(2)9-11-15;/h8-11,16,24H,7,12-13H2,1-6H3,(H,20,21)(H,22,25);1H |
| InChIKey | ADPDUFLMZGBXLE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|