C15H29F3IN5O2 — CID 111501468
2-[[[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111501468) has the molecular formula C15H29F3IN5O2 and a molecular weight of 495.33 g/mol. Its IUPAC name is 2-[[[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111501468 |
| Molecular Formula | C15H29F3IN5O2 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-[[[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)N(C)CC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C15H28F3N5O2.HI/c1-7-19-13(22(5)9-11(24)21-14(2,3)4)20-8-12(25)23(6)10-15(16,17)18;/h7-10H2,1-6H3,(H,19,20)(H,21,24);1H |
| InChIKey | KRWGLUIOVQWKMG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|