C17H26N2O3 — CID 111379146
N-[[1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]acetamide (PubChem CID 111379146) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[[1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]acetamide.
| Compound Name | N-[[1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 111379146 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[[1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]acetamide |
| SMILES | COc1cccc(C(O)CN2CCCC(CNC(C)=O)C2)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-13(20)18-10-14-5-4-8-19(11-14)12-17(21)15-6-3-7-16(9-15)22-2/h3,6-7,9,14,17,21H,4-5,8,10-12H2,1-2H3,(H,18,20) |
| InChIKey | DAMANHBCLZNFBM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |