C19H28N4O — CID 111381422
3-[methyl-[1-[(1-phenylpyrazol-4-yl)methyl]piperidin-4-yl]amino]propan-1-ol (PubChem CID 111381422) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-[methyl-[1-[(1-phenylpyrazol-4-yl)methyl]piperidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[methyl-[1-[(1-phenylpyrazol-4-yl)methyl]piperidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 111381422 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-[methyl-[1-[(1-phenylpyrazol-4-yl)methyl]piperidin-4-yl]amino]propan-1-ol |
| SMILES | CN(CCCO)C1CCN(Cc2cnn(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C19H28N4O/c1-21(10-5-13-24)18-8-11-22(12-9-18)15-17-14-20-23(16-17)19-6-3-2-4-7-19/h2-4,6-7,14,16,18,24H,5,8-13,15H2,1H3 |
| InChIKey | UAIDIKAYIBQGGS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |