C21H24N4 — CID 126605115
1-methyl-4-[[1-(4-phenylphenyl)pyrazol-4-yl]methyl]piperazine (PubChem CID 126605115) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-methyl-4-[[1-(4-phenylphenyl)pyrazol-4-yl]methyl]piperazine.
| Compound Name | 1-methyl-4-[[1-(4-phenylphenyl)pyrazol-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 126605115 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-methyl-4-[[1-(4-phenylphenyl)pyrazol-4-yl]methyl]piperazine |
| SMILES | CN1CCN(Cc2cnn(-c3ccc(-c4ccccc4)cc3)c2)CC1 |
| InChI | InChI=1S/C21H24N4/c1-23-11-13-24(14-12-23)16-18-15-22-25(17-18)21-9-7-20(8-10-21)19-5-3-2-4-6-19/h2-10,15,17H,11-14,16H2,1H3 |
| InChIKey | GRCFNXQYPAOEQA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |