C17H21F3N4O — CID 135659014
2-[4-[[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methyl]piperazin-1-yl]ethanol (PubChem CID 135659014) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-[4-[[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 135659014 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[4-[[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(Cc2cnn(-c3ccc(C(F)(F)F)cc3)c2)CC1 |
| InChI | InChI=1S/C17H21F3N4O/c18-17(19,20)15-1-3-16(4-2-15)24-13-14(11-21-24)12-23-7-5-22(6-8-23)9-10-25/h1-4,11,13,25H,5-10,12H2 |
| InChIKey | ANALDIHCCGMAEX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |