C20H32IN3O4S — CID 111381687
1-[(1,1-dioxothiolan-3-yl)methyl]-2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111381687) has the molecular formula C20H32IN3O4S and a molecular weight of 537.46 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111381687 |
| Molecular Formula | C20H32IN3O4S |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc2c(cc1OCC)CC(C)O2)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C20H31N3O4S.HI/c1-4-21-20(22-11-15-6-7-28(24,25)13-15)23-12-17-10-19-16(8-14(3)27-19)9-18(17)26-5-2;/h9-10,14-15H,4-8,11-13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | BREDYTKYYBUPCI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|