C20H35IN4O4S — CID 111786540
2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 111786540) has the molecular formula C20H35IN4O4S and a molecular weight of 554.50 g/mol. Its IUPAC name is 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111786540 |
| Molecular Formula | C20H35IN4O4S |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc2c(cc1OCC)CC(C)O2)NCC(C)(C)NS(C)(=O)=O.I |
| InChI | InChI=1S/C20H34N4O4S.HI/c1-7-21-19(23-13-20(4,5)24-29(6,25)26)22-12-16-11-18-15(9-14(3)28-18)10-17(16)27-8-2;/h10-11,14,24H,7-9,12-13H2,1-6H3,(H2,21,22,23);1H |
| InChIKey | LMHWFSDULSOWQT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|