C23H31N3O3 — CID 111381806
1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-[[2-(methoxymethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111381806) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-[[2-(methoxymethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-[[2-(methoxymethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111381806 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-[[2-(methoxymethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | CCOc1cc2c(cc1CN/C(=N/C)NCc1ccccc1COC)OC(C)C2 |
| InChI | InChI=1S/C23H31N3O3/c1-5-28-21-11-19-10-16(2)29-22(19)12-20(21)14-26-23(24-3)25-13-17-8-6-7-9-18(17)15-27-4/h6-9,11-12,16H,5,10,13-15H2,1-4H3,(H2,24,25,26) |
| InChIKey | MXVDFZRMQZSQQN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|