C24H35IN4O3 — CID 111382088
1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111382088) has the molecular formula C24H35IN4O3 and a molecular weight of 554.47 g/mol. Its IUPAC name is 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111382088 |
| Molecular Formula | C24H35IN4O3 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-3-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1cc2c(cc1CN/C(=N/C)NCc1ccc(NCCOC)cc1)OC(C)C2.I |
| InChI | InChI=1S/C24H34N4O3.HI/c1-5-30-22-13-19-12-17(2)31-23(19)14-20(22)16-28-24(25-3)27-15-18-6-8-21(9-7-18)26-10-11-29-4;/h6-9,13-14,17,26H,5,10-12,15-16H2,1-4H3,(H2,25,27,28);1H |
| InChIKey | HEFRDEMVENOLEO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|