C19H32IN3O5S — CID 111518616
1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111518616) has the molecular formula C19H32IN3O5S and a molecular weight of 541.45 g/mol. Its IUPAC name is 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111518616 |
| Molecular Formula | C19H32IN3O5S |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCOc1cc2c(cc1CN/C(=N/C)NCCOCCS(C)(=O)=O)OC(C)C2.I |
| InChI | InChI=1S/C19H31N3O5S.HI/c1-5-26-17-11-15-10-14(2)27-18(15)12-16(17)13-22-19(20-3)21-6-7-25-8-9-28(4,23)24;/h11-12,14H,5-10,13H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | BYZDNCKMMLGSFL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|