C21H35IN4O4S — CID 111786516
1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111786516) has the molecular formula C21H35IN4O4S and a molecular weight of 566.51 g/mol. Its IUPAC name is 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111786516 |
| Molecular Formula | C21H35IN4O4S |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1cc2c(cc1CN/C(=N/C)NCCS(=O)(=O)NCC1CCC1)OC(C)C2.I |
| InChI | InChI=1S/C21H34N4O4S.HI/c1-4-28-19-11-17-10-15(2)29-20(17)12-18(19)14-24-21(22-3)23-8-9-30(26,27)25-13-16-6-5-7-16;/h11-12,15-16,25H,4-10,13-14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | PSSHPTUCMUCZSR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|