C21H32IN5O2 — CID 111382191
1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[3-(4-methylpyrazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111382191) has the molecular formula C21H32IN5O2 and a molecular weight of 513.42 g/mol. Its IUPAC name is 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[3-(4-methylpyrazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[3-(4-methylpyrazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111382191 |
| Molecular Formula | C21H32IN5O2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[3-(4-methylpyrazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCOc1cc2c(cc1CN/C(=N/C)NCCCn1cc(C)cn1)OC(C)C2.I |
| InChI | InChI=1S/C21H31N5O2.HI/c1-5-27-19-10-17-9-16(3)28-20(17)11-18(19)13-24-21(22-4)23-7-6-8-26-14-15(2)12-25-26;/h10-12,14,16H,5-9,13H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | JRRFDWZKPYTVDI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|