C11H15NO3 — CID 11138334
(2E)-2-phenylmethoxyiminobutane-1,3-diol (PubChem CID 11138334) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (2E)-2-phenylmethoxyiminobutane-1,3-diol.
| Compound Name | (2E)-2-phenylmethoxyiminobutane-1,3-diol |
|---|---|
| PubChem CID | 11138334 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (2E)-2-phenylmethoxyiminobutane-1,3-diol |
| SMILES | CC(O)/C(CO)=N/OCc1ccccc1 |
| InChI | InChI=1S/C11H15NO3/c1-9(14)11(7-13)12-15-8-10-5-3-2-4-6-10/h2-6,9,13-14H,7-8H2,1H3/b12-11+ |
| InChIKey | ILEZKYOIXVGRKD-VAWYXSNFSA-N |
| XLogP | 0.93 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|