C16H31N5O2 — CID 111383938
2-[[N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide (PubChem CID 111383938) has the molecular formula C16H31N5O2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-[[N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111383938 |
| Molecular Formula | C16H31N5O2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 2-[[N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C16H31N5O2/c1-16(2,3)20-14(22)9-19-15(17-4)18-8-13-10-21-7-5-6-12(21)11-23-13/h12-13H,5-11H2,1-4H3,(H,20,22)(H2,17,18,19) |
| InChIKey | RFLXPELQKSGDKL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|