C19H37IN4O — CID 111947512
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-(3-cyclohexylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 111947512) has the molecular formula C19H37IN4O and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-(3-cyclohexylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-(3-cyclohexylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111947512 |
| Molecular Formula | C19H37IN4O |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-(3-cyclohexylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC1CCCCC1)NCC1CN2CCCC2CO1.I |
| InChI | InChI=1S/C19H36N4O.HI/c1-20-19(21-11-5-9-16-7-3-2-4-8-16)22-13-18-14-23-12-6-10-17(23)15-24-18;/h16-18H,2-15H2,1H3,(H2,20,21,22);1H |
| InChIKey | UUMDJXXPSVRMEI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|