C22H36IN5O3 — CID 111385283
N-tert-butyl-2-[[[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111385283) has the molecular formula C22H36IN5O3 and a molecular weight of 545.47 g/mol. Its IUPAC name is N-tert-butyl-2-[[[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111385283 |
| Molecular Formula | C22H36IN5O3 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | N-tert-butyl-2-[[[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCc1ccc(OCC(=O)NC2CC2)cc1.I |
| InChI | InChI=1S/C22H35N5O3.HI/c1-5-23-21(25-14-19(28)27-22(2,3)4)24-13-12-16-6-10-18(11-7-16)30-15-20(29)26-17-8-9-17;/h6-7,10-11,17H,5,8-9,12-15H2,1-4H3,(H,26,29)(H,27,28)(H2,23,24,25);1H |
| InChIKey | SQTFTQLODMYQMD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|