C23H32N4O3S — CID 109419596
N-cyclopropyl-2-[4-[2-[[N-ethyl-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide (PubChem CID 109419596) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-[[N-ethyl-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[2-[[N-ethyl-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 109419596 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-[[N-ethyl-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCc1ccc(OCC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C23H32N4O3S/c1-3-24-22(26-16-23(2,29)20-5-4-14-31-20)25-13-12-17-6-10-19(11-7-17)30-15-21(28)27-18-8-9-18/h4-7,10-11,14,18,29H,3,8-9,12-13,15-16H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | WYBNTHXXUMTKNX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|