C23H37N5O2 — CID 111386668
N-[3-[[[N'-methyl-N-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 111386668) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[N'-methyl-N-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 111386668 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | C/N=C(\NCCCN1CCC(C)CC1)NCc1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C23H37N5O2/c1-18-9-13-28(14-10-18)12-5-11-25-23(24-2)26-17-19-6-3-7-20(16-19)27-22(29)21-8-4-15-30-21/h3,6-7,16,18,21H,4-5,8-15,17H2,1-2H3,(H,27,29)(H2,24,25,26) |
| InChIKey | ZHQPHFQFOKXYMH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|