C22H35IN4O4 — CID 111646675
N-[3-[[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111646675) has the molecular formula C22H35IN4O4 and a molecular weight of 546.45 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111646675 |
| Molecular Formula | C22H35IN4O4 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOC1)NCc1cccc(NC(=O)C2CCCO2)c1.I |
| InChI | InChI=1S/C22H34N4O4.HI/c1-23-22(24-9-4-10-28-15-18-8-12-29-16-18)25-14-17-5-2-6-19(13-17)26-21(27)20-7-3-11-30-20;/h2,5-6,13,18,20H,3-4,7-12,14-16H2,1H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | QJVMKWMEIBKRIK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|