C22H29F3IN3O2 — CID 111389654
1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111389654) has the molecular formula C22H29F3IN3O2 and a molecular weight of 551.39 g/mol. Its IUPAC name is 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111389654 |
| Molecular Formula | C22H29F3IN3O2 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 1-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(C)ccc1OC)NCc1ccc(COCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C22H28F3N3O2.HI/c1-16-4-9-20(29-3)19(12-16)10-11-27-21(26-2)28-13-17-5-7-18(8-6-17)14-30-15-22(23,24)25;/h4-9,12H,10-11,13-15H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | AHAWMPWZLPKLDL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|