C20H33N5O — CID 111390111
N-[2-[[N-ethyl-N'-[3-(N-ethylanilino)propyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111390111) has the molecular formula C20H33N5O and a molecular weight of 359.52 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[3-(N-ethylanilino)propyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[3-(N-ethylanilino)propyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111390111 |
| Molecular Formula | C20H33N5O |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[3-(N-ethylanilino)propyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CCCN(CC)c1ccccc1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C20H33N5O/c1-3-21-20(24-15-14-22-19(26)17-11-12-17)23-13-8-16-25(4-2)18-9-6-5-7-10-18/h5-7,9-10,17H,3-4,8,11-16H2,1-2H3,(H,22,26)(H2,21,23,24) |
| InChIKey | ZEMNFPRIRYSONP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|