C18H28N6 — CID 111390427
1-[3-(N-ethylanilino)propyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine (PubChem CID 111390427) has the molecular formula C18H28N6 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[3-(N-ethylanilino)propyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine.
| Compound Name | 1-[3-(N-ethylanilino)propyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111390427 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 1-[3-(N-ethylanilino)propyl]-3-(2-imidazol-1-ylethyl)-2-methylguanidine |
| SMILES | CCN(CCCN/C(=N/C)NCCn1ccnc1)c1ccccc1 |
| InChI | InChI=1S/C18H28N6/c1-3-24(17-8-5-4-6-9-17)13-7-10-21-18(19-2)22-12-15-23-14-11-20-16-23/h4-6,8-9,11,14,16H,3,7,10,12-13,15H2,1-2H3,(H2,19,21,22) |
| InChIKey | INLYGNZFGFNXOM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|