C16H32IN3O3 — CID 111391910
methyl 5-[[N'-[3-(cyclopropylmethoxy)propyl]-N-ethylcarbamimidoyl]amino]pentanoate;hydroiodide (PubChem CID 111391910) has the molecular formula C16H32IN3O3 and a molecular weight of 441.35 g/mol. Its IUPAC name is methyl 5-[[N'-[3-(cyclopropylmethoxy)propyl]-N-ethylcarbamimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N'-[3-(cyclopropylmethoxy)propyl]-N-ethylcarbamimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 111391910 |
| Molecular Formula | C16H32IN3O3 |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | methyl 5-[[N'-[3-(cyclopropylmethoxy)propyl]-N-ethylcarbamimidoyl]amino]pentanoate;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CC1)NCCCCC(=O)OC.I |
| InChI | InChI=1S/C16H31N3O3.HI/c1-3-17-16(18-10-5-4-7-15(20)21-2)19-11-6-12-22-13-14-8-9-14;/h14H,3-13H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | JOLAVAAHNPZJHW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|