C18H35N3O4 — CID 111644660
ethyl 4-[[ethylamino-[3-(oxan-4-ylmethoxy)propylamino]methylidene]amino]butanoate (PubChem CID 111644660) has the molecular formula C18H35N3O4 and a molecular weight of 357.50 g/mol. Its IUPAC name is ethyl 4-[[ethylamino-[3-(oxan-4-ylmethoxy)propylamino]methylidene]amino]butanoate.
| Compound Name | ethyl 4-[[ethylamino-[3-(oxan-4-ylmethoxy)propylamino]methylidene]amino]butanoate |
|---|---|
| PubChem CID | 111644660 |
| Molecular Formula | C18H35N3O4 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.26 |
| IUPAC Name | ethyl 4-[[ethylamino-[3-(oxan-4-ylmethoxy)propylamino]methylidene]amino]butanoate |
| SMILES | CCN/C(=N\CCCC(=O)OCC)NCCCOCC1CCOCC1 |
| InChI | InChI=1S/C18H35N3O4/c1-3-19-18(20-10-5-7-17(22)25-4-2)21-11-6-12-24-15-16-8-13-23-14-9-16/h16H,3-15H2,1-2H3,(H2,19,20,21) |
| InChIKey | BDJMTMIMTYXTNW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|