C22H38IN5O — CID 111392808
2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-[3-(cyclopropylmethoxy)propyl]-3-ethylguanidine;hydroiodide (PubChem CID 111392808) has the molecular formula C22H38IN5O and a molecular weight of 515.48 g/mol. Its IUPAC name is 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-[3-(cyclopropylmethoxy)propyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-[3-(cyclopropylmethoxy)propyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111392808 |
| Molecular Formula | C22H38IN5O |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-[3-(cyclopropylmethoxy)propyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCCCC2)nc1)NCCCOCC1CC1.I |
| InChI | InChI=1S/C22H37N5O.HI/c1-2-23-22(24-12-7-15-28-18-19-8-9-19)26-17-20-10-11-21(25-16-20)27-13-5-3-4-6-14-27;/h10-11,16,19H,2-9,12-15,17-18H2,1H3,(H2,23,24,26);1H |
| InChIKey | LJDZSFXYRRJQHH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|