C26H39N5O — CID 111394507
1-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-ethyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111394507) has the molecular formula C26H39N5O and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-ethyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-ethyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111394507 |
| Molecular Formula | C26H39N5O |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.32 |
| IUPAC Name | 1-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-ethyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2)cc1)NCc1ccccc1OCCN(C)C |
| InChI | InChI=1S/C26H39N5O/c1-4-27-26(29-20-24-9-5-6-10-25(24)32-18-17-30(2)3)28-19-22-11-13-23(14-12-22)21-31-15-7-8-16-31/h5-6,9-14H,4,7-8,15-21H2,1-3H3,(H2,27,28,29) |
| InChIKey | JHYPQQCAAPYEJI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|