C20H36FIN4 — CID 111394956
2-[7-(dimethylamino)heptyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111394956) has the molecular formula C20H36FIN4 and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-[7-(dimethylamino)heptyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[7-(dimethylamino)heptyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111394956 |
| Molecular Formula | C20H36FIN4 |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[7-(dimethylamino)heptyl]-1-ethyl-3-[2-(3-fluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCCCCN(C)C)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C20H35FN4.HI/c1-4-22-20(23-14-8-6-5-7-9-16-25(2)3)24-15-13-18-11-10-12-19(21)17-18;/h10-12,17H,4-9,13-16H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | OQHMIXWIMMVXPA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|