C16H24F4IN3O — CID 111395696
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111395696) has the molecular formula C16H24F4IN3O and a molecular weight of 477.28 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111395696 |
| Molecular Formula | C16H24F4IN3O |
| Molecular Weight | 477.28 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C16H23F4N3O.HI/c1-2-21-15(22-8-4-10-24-12-16(18,19)20)23-9-7-13-5-3-6-14(17)11-13;/h3,5-6,11H,2,4,7-10,12H2,1H3,(H2,21,22,23);1H |
| InChIKey | TXIUFLDAMFQRJQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|