C15H20BrN3O2S — CID 111398573
1-[(4-bromothiophen-2-yl)methyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine (PubChem CID 111398573) has the molecular formula C15H20BrN3O2S and a molecular weight of 386.32 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111398573 |
| Molecular Formula | C15H20BrN3O2S |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C15H20BrN3O2S/c1-17-15(19-9-14-8-12(16)11-22-14)18-5-3-6-20-10-13-4-2-7-21-13/h2,4,7-8,11H,3,5-6,9-10H2,1H3,(H2,17,18,19) |
| InChIKey | ZOTUQBJHLYUKPR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|