C15H22N4O4S2 — CID 111398427
1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111398427) has the molecular formula C15H22N4O4S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111398427 |
| Molecular Formula | C15H22N4O4S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C15H22N4O4S2/c1-17-15(18-7-3-8-22-11-12-4-2-9-23-12)19-10-13-5-6-14(24-13)25(16,20)21/h2,4-6,9H,3,7-8,10-11H2,1H3,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | WFPLUDFUBAXJNS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|