C21H28IN5O2 — CID 111399258
1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111399258) has the molecular formula C21H28IN5O2 and a molecular weight of 509.39 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111399258 |
| Molecular Formula | C21H28IN5O2 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C21H27N5O2.HI/c1-22-21(23-11-4-15-27-17-20-5-2-16-28-20)24-13-10-18-6-8-19(9-7-18)26-14-3-12-25-26;/h2-3,5-9,12,14,16H,4,10-11,13,15,17H2,1H3,(H2,22,23,24);1H |
| InChIKey | ZCLCWMKGSFVTJV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|