C20H26IN5O2 — CID 111399058
1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111399058) has the molecular formula C20H26IN5O2 and a molecular weight of 495.37 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111399058 |
| Molecular Formula | C20H26IN5O2 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C20H25N5O2.HI/c1-21-20(22-10-4-13-26-16-19-5-2-14-27-19)23-15-17-6-8-18(9-7-17)25-12-3-11-24-25;/h2-3,5-9,11-12,14H,4,10,13,15-16H2,1H3,(H2,21,22,23);1H |
| InChIKey | YSXJXIXAKBDNRH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|