C10H16O6S — CID 11139986
1-O-ethyl 4-O-methyl (2R,3S)-2-methoxycarbonylsulfanyl-3-methylbutanedioate (PubChem CID 11139986) has the molecular formula C10H16O6S and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl (2R,3S)-2-methoxycarbonylsulfanyl-3-methylbutanedioate.
| Compound Name | 1-O-ethyl 4-O-methyl (2R,3S)-2-methoxycarbonylsulfanyl-3-methylbutanedioate |
|---|---|
| PubChem CID | 11139986 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-O-ethyl 4-O-methyl (2R,3S)-2-methoxycarbonylsulfanyl-3-methylbutanedioate |
| SMILES | CCOC(=O)[C@H](SC(=O)OC)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C10H16O6S/c1-5-16-9(12)7(17-10(13)15-4)6(2)8(11)14-3/h6-7H,5H2,1-4H3/t6-,7-/m1/s1 |
| InChIKey | YXCZQUXAYPRIOI-RNFRBKRXSA-N |
| XLogP | 1.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|