C18H31IN4O3 — CID 111402612
2-[[ethylamino-[3-(2-methylpropoxy)propylamino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide (PubChem CID 111402612) has the molecular formula C18H31IN4O3 and a molecular weight of 478.38 g/mol. Its IUPAC name is 2-[[ethylamino-[3-(2-methylpropoxy)propylamino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[3-(2-methylpropoxy)propylamino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111402612 |
| Molecular Formula | C18H31IN4O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[[ethylamino-[3-(2-methylpropoxy)propylamino]methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(O)cc1)NCCCOCC(C)C.I |
| InChI | InChI=1S/C18H30N4O3.HI/c1-4-19-18(20-10-5-11-25-13-14(2)3)21-12-17(24)22-15-6-8-16(23)9-7-15;/h6-9,14,23H,4-5,10-13H2,1-3H3,(H,22,24)(H2,19,20,21);1H |
| InChIKey | KTMQQDLKPPHUEI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|