C19H26FIN4O3 — CID 111398916
2-[[ethylamino-[3-(furan-2-ylmethoxy)propylamino]methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111398916) has the molecular formula C19H26FIN4O3 and a molecular weight of 504.34 g/mol. Its IUPAC name is 2-[[ethylamino-[3-(furan-2-ylmethoxy)propylamino]methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[3-(furan-2-ylmethoxy)propylamino]methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111398916 |
| Molecular Formula | C19H26FIN4O3 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-[[ethylamino-[3-(furan-2-ylmethoxy)propylamino]methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)cc1)NCCCOCc1ccco1.I |
| InChI | InChI=1S/C19H25FN4O3.HI/c1-2-21-19(22-10-4-11-26-14-17-5-3-12-27-17)23-13-18(25)24-16-8-6-15(20)7-9-16;/h3,5-9,12H,2,4,10-11,13-14H2,1H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | OXUSWNOQYFZTPY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|