C23H33IN4O4 — CID 111871084
N-cyclopropyl-2-[[[3-(furan-2-ylmethoxy)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111871084) has the molecular formula C23H33IN4O4 and a molecular weight of 556.45 g/mol. Its IUPAC name is N-cyclopropyl-2-[[[3-(furan-2-ylmethoxy)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[[[3-(furan-2-ylmethoxy)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111871084 |
| Molecular Formula | C23H33IN4O4 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-cyclopropyl-2-[[[3-(furan-2-ylmethoxy)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)Oc1ccc(N/C(=N/CC(=O)NC2CC2)NCCCOCc2ccco2)cc1.I |
| InChI | InChI=1S/C23H32N4O4.HI/c1-17(2)31-20-10-8-19(9-11-20)27-23(25-15-22(28)26-18-6-7-18)24-12-4-13-29-16-21-5-3-14-30-21;/h3,5,8-11,14,17-18H,4,6-7,12-13,15-16H2,1-2H3,(H,26,28)(H2,24,25,27);1H |
| InChIKey | SGTBBTXONRYSFV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|