C20H38IN5O2 — CID 111407768
2-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111407768) has the molecular formula C20H38IN5O2 and a molecular weight of 507.46 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111407768 |
| Molecular Formula | C20H38IN5O2 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Cn1nc(C)cc1C)NCCCOCC1CCCO1.I |
| InChI | InChI=1S/C20H37N5O2.HI/c1-5-21-20(22-9-7-10-26-15-19-8-6-11-27-19)23-13-16(2)14-25-18(4)12-17(3)24-25;/h12,16,19H,5-11,13-15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | YVYVXRMJLLXTSP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|