C20H38N6O2 — CID 111887163
tert-butyl N-[3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887163) has the molecular formula C20H38N6O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887163 |
| Molecular Formula | C20H38N6O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | tert-butyl N-[3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CC(C)Cn1nc(C)cc1C)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38N6O2/c1-8-21-18(22-10-9-11-23-19(27)28-20(5,6)7)24-13-15(2)14-26-17(4)12-16(3)25-26/h12,15H,8-11,13-14H2,1-7H3,(H,23,27)(H2,21,22,24) |
| InChIKey | XFFZTOJWDDHGQD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|