C19H36N6O — CID 111942025
3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide (PubChem CID 111942025) has the molecular formula C19H36N6O and a molecular weight of 364.54 g/mol. Its IUPAC name is 3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide.
| Compound Name | 3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 111942025 |
| Molecular Formula | C19H36N6O |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 3-[[N'-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide |
| SMILES | CCN/C(=N\CC(C)Cn1nc(C)cc1C)NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C19H36N6O/c1-7-20-19(21-11-10-18(26)24(8-2)9-3)22-13-15(4)14-25-17(6)12-16(5)23-25/h12,15H,7-11,13-14H2,1-6H3,(H2,20,21,22) |
| InChIKey | TTXMGAMNIIPDHY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|