C22H36N4O3 — CID 111409069
2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111409069) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111409069 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(OC2CCCC2)c1)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C22H36N4O3/c1-2-23-22(25-11-6-13-27-17-20-9-5-14-28-20)26-16-18-10-12-24-21(15-18)29-19-7-3-4-8-19/h10,12,15,19-20H,2-9,11,13-14,16-17H2,1H3,(H2,23,25,26) |
| InChIKey | KZGHUGPAOBOGQY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|