C22H39IN6O2 — CID 111409728
1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111409728) has the molecular formula C22H39IN6O2 and a molecular weight of 546.50 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111409728 |
| Molecular Formula | C22H39IN6O2 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCN(C)CC2)c1)NCCCOCC1CCCO1.I |
| InChI | InChI=1S/C22H38N6O2.HI/c1-3-23-22(25-8-5-14-29-18-20-6-4-15-30-20)26-17-19-7-9-24-21(16-19)28-12-10-27(2)11-13-28;/h7,9,16,20H,3-6,8,10-15,17-18H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | ULENQKMCOFYHGU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|