C25H36N6O — CID 111411763
N-methyl-2-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 111411763) has the molecular formula C25H36N6O and a molecular weight of 436.60 g/mol. Its IUPAC name is N-methyl-2-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | N-methyl-2-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 111411763 |
| Molecular Formula | C25H36N6O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | N-methyl-2-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)CCc1ccccn1)NCc1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C25H36N6O/c1-26-25(29-19-24(32)30(2)17-13-23-8-4-5-14-27-23)28-18-21-9-11-22(12-10-21)20-31-15-6-3-7-16-31/h4-5,8-12,14H,3,6-7,13,15-20H2,1-2H3,(H2,26,28,29) |
| InChIKey | NGUYXANGAPUMQD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|