C15H30O4Si — CID 11141190
tert-butyl-[(2R,3R)-3-(methoxymethoxy)-2-[(2S)-oxiran-2-yl]pent-4-enoxy]-dimethylsilane (PubChem CID 11141190) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-3-(methoxymethoxy)-2-[(2S)-oxiran-2-yl]pent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R)-3-(methoxymethoxy)-2-[(2S)-oxiran-2-yl]pent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11141190 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | tert-butyl-[(2R,3R)-3-(methoxymethoxy)-2-[(2S)-oxiran-2-yl]pent-4-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H](OCOC)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CO1 |
| InChI | InChI=1S/C15H30O4Si/c1-8-13(18-11-16-5)12(14-10-17-14)9-19-20(6,7)15(2,3)4/h8,12-14H,1,9-11H2,2-7H3/t12-,13-,14-/m1/s1 |
| InChIKey | RDULBEROSULTMT-MGPQQGTHSA-N |
| XLogP | 3.20 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|